![1-[2-(methylamino)ethyl]cyclopentan-1-ol (CAS: 959238-35-8) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0718261.png "1-[2-(methylamino)ethyl]cyclopentan-1-ol chemical structure")
1-[2-(methylamino)ethyl]cyclopentan-1-ol
Catalog No: FT-0718261
CAS No: 959238-35-8
- Chemical Name: 1-[2-(methylamino)ethyl]cyclopentan-1-ol
- Molecular Formula: C8H17NO
- Molecular Weight: 143.23
- InChI Key: ULWCQTYWQPOPFV-UHFFFAOYSA-N
- InChI: InChI=1S/C8H17NO/c1-9-7-6-8(10)4-2-3-5-8/h9-10H,2-7H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 959238-35-8 |
|---|---|
| MF: | C8H17NO |
| Density: | 0.974g/cm3 |
| Flash_Point: | 72.2ºC |
| Melting_Point: | N/A |
| Product_Name: | 1-[2-(methylamino)ethyl]cyclopentan-1-ol |
| Symbol: | GHS07 |
| Bolling_Point: | 215.5ºC at 760 mmHg |
| FW: | 143.22700 |
| Density: | 0.974g/cm3 |
|---|---|
| MF: | C8H17NO |
| LogP: | 1.29190 |
| Exact_Mass: | 143.13100 |
| Bolling_Point: | 215.5ºC at 760 mmHg |
| Flash_Point: | 72.2ºC |
| FW: | 143.22700 |
| Refractive_Index: | 1.484 |
| PSA: | 32.26000 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2922199090 |
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 |
